A student investigates the esterification reaction between ethanoic acid, CH3COOH(l)\text{CH}_3\text{COOH}(\text{l})CH3COOH(l), and ethanol, C2H5OH(l)\text{C}_2\text{H}_5\text{OH}(\text{l})C2H5OH(l), in the presence of an acid catalyst to produce ethyl ethanoate and water:
CH3COOH(l)+C2H5OH(l)⇌CH3COOC2H5(l)+H2O(l) \text{CH}_3\text{COOH}(\text{l}) + \text{C}_2\text{H}_5\text{OH}(\text{l}) \rightleftharpoons \text{CH}_3\text{COOC}_2\text{H}_5(\text{l}) + \text{H}_2\text{O}(\text{l}) CH3COOH(l)+C2H5OH(l)⇌CH3COOC2H5(l)+H2O(l)Explain why performing the kinetic study with a large excess of ethanol allows the order of reaction with respect to ethanoic acid to be determined directly.
In a separate experiment to determine the equilibrium constant, KcK_cKc, the student mixes 13.8 g13.8\text{ g}13.8 g of ethanol (C2H5OH\text{C}_2\text{H}_5\text{OH}C2H5OH) with 15.0 g15.0\text{ g}15.0 g of ethanoic acid (CH3COOH\text{CH}_3\text{COOH}CH3COOH) and adds a small amount of acid catalyst.
When the mixture reaches equilibrium at constant temperature, 0.050 mol0.050\text{ mol}0.050 mol of CH3COOH\text{CH}_3\text{COOH}CH3COOH remains.
Calculate the value of KcK_cKc for this equilibrium.