Skip to content
MathsGenie logo
Open app

Course home

  1. A Level
  2. Chemistry OCR A
  3. Question bank

Physical chemistry

EasyMediumHard
12345678910111213141516171819202122232425262728293031323334353637383940414243444546
Question 43

An imine (specifically N-benzylidenemethylamine, C6H5CH=NCH3\text{C}_6\text{H}_5\text{CH=NCH}_3C6​H5​CH=NCH3​) can be prepared via the condensation reaction between benzaldehyde and methylamine in an aqueous equilibrium mixture:

C6H5CHO(aq)+CH3NH2(aq)⇌C6H5CH=NCH3(aq)+H2O(l)Kc=1.25 dm3 mol−1 \text{C}_6\text{H}_5\text{CHO}(\text{aq}) + \text{CH}_3\text{NH}_2(\text{aq}) \rightleftharpoons \text{C}_6\text{H}_5\text{CH=NCH}_3(\text{aq}) + \text{H}_2\text{O}(\text{l}) \quad K_c = 1.25 \text{ dm}^3 \text{ mol}^{-1} C6​H5​CHO(aq)+CH3​NH2​(aq)⇌C6​H5​CH=NCH3​(aq)+H2​O(l)Kc​=1.25 dm3 mol−1

An 800 cm3800 \text{ cm}^3800 cm3 aqueous equilibrium mixture contains concentrations of 0.450 mol dm−30.450 \text{ mol dm}^{-3}0.450 mol dm−3 benzaldehyde (C6H5CHO\text{C}_6\text{H}_5\text{CHO}C6​H5​CHO) and 0.640 mol dm−30.640 \text{ mol dm}^{-3}0.640 mol dm−3 methylamine (CH3NH2\text{CH}_3\text{NH}_2CH3​NH2​).

Calculate the amount, in mol, of N-benzylidenemethylamine in this equilibrium mixture.

[3]

Physical chemistry Questions

  1. A Level
  2. /Chemistry
  3. /Physical chemistry