Halogenoalkanes

EasyMedium
123456789101112131415161718192021222324
Question 5
Medium

This question is about the preparation and reactions of aliphatic amines.

a.

An incomplete equation for Step 1 in the reaction between 1-bromobutane and an amine to form an ammonium salt is shown below:

CH3CH2CH2CH2Br+Amine⟶[CH3CH2CH2CH2NH2CH2CH2CH3]+Br−\text{CH}_3\text{CH}_2\text{CH}_2\text{CH}_2\text{Br} + \text{Amine} \longrightarrow [\text{CH}_3\text{CH}_2\text{CH}_2\text{CH}_2\text{NH}_2\text{CH}_2\text{CH}_2\text{CH}_3]^+ \text{Br}^-CH3​CH2​CH2​CH2​Br+Amine⟶[CH3​CH2​CH2​CH2​NH2​CH2​CH2​CH3​]+Br−

  1. Give the structural formula of the Amine.
  2. In Step 2 of this reaction, the salt product from Step 1 is converted into a secondary amine. Give the IUPAC name of this secondary amine.
[2]
b.

2-bromobutane (CH3CHBrCH2CH3\text{CH}_3\text{CHBrCH}_2\text{CH}_3CH3​CHBrCH2​CH3​) reacts with ammonia (NH3\text{NH}_3NH3​).

  1. Give the structural formula of the major organic product formed when an excess of NH3\text{NH}_3NH3​ is used.
  2. Give the structural formula of the major organic cation formed when an excess of CH3CHBrCH2CH3\text{CH}_3\text{CHBrCH}_2\text{CH}_3CH3​CHBrCH2​CH3​ is used.
[2]

Halogenoalkanes Questions

  1. A Level
  2. /Chemistry
  3. /Halogenoalkanes